C40H64O2 — CID 78115635
8-[2-[(2-pentylcyclopropyl)methyl]cyclopropyl]octyl 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 78115635) has the molecular formula C40H64O2 and a molecular weight of 576.95 g/mol. Its IUPAC name is 8-[2-[(2-pentylcyclopropyl)methyl]cyclopropyl]octyl 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | 8-[2-[(2-pentylcyclopropyl)methyl]cyclopropyl]octyl 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 78115635 |
| Molecular Formula | C40H64O2 |
| Molecular Weight | 576.95 g/mol |
| Exact Mass | 576.49 |
| IUPAC Name | 8-[2-[(2-pentylcyclopropyl)methyl]cyclopropyl]octyl 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CCCCCC1CC1CC1CC1CCCCCCCCOC(=O)C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H64O2/c1-7-8-13-21-34-28-36(34)30-37-29-35(37)22-14-11-9-10-12-15-26-42-39(41)27-32(3)19-16-18-31(2)23-24-38-33(4)20-17-25-40(38,5)6/h16,18-19,23-24,27,34-37H,7-15,17,20-22,25-26,28-30H2,1-6H3 |
| InChIKey | XNQWRCWFLXWGER-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.95 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|