C31H42O2S — CID 88702298
octyl 2-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxylate (PubChem CID 88702298) has the molecular formula C31H42O2S and a molecular weight of 478.74 g/mol. Its IUPAC name is octyl 2-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxylate.
| Compound Name | octyl 2-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxylate |
|---|---|
| PubChem CID | 88702298 |
| Molecular Formula | C31H42O2S |
| Molecular Weight | 478.74 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | octyl 2-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxylate |
| SMILES | CCCCCCCCOC(=O)c1ccc2cc(/C=C(\C)C=CC3=C(C)CCCC3(C)C)sc2c1 |
| InChI | InChI=1S/C31H42O2S/c1-6-7-8-9-10-11-19-33-30(32)26-16-15-25-21-27(34-29(25)22-26)20-23(2)14-17-28-24(3)13-12-18-31(28,4)5/h14-17,20-22H,6-13,18-19H2,1-5H3/b17-14?,23-20+ |
| InChIKey | SYEGIPQHANRXOI-JUPFMTRCSA-N |
| XLogP | 9.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.74 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|