C26H40N2O2 — CID 54534501
octyl 5-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1H-imidazole-2-carboxylate (PubChem CID 54534501) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is octyl 5-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1H-imidazole-2-carboxylate.
| Compound Name | octyl 5-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1H-imidazole-2-carboxylate |
|---|---|
| PubChem CID | 54534501 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | octyl 5-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1H-imidazole-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)c1ncc(C=C(C)C=CC2=C(C)CCCC2(C)C)[nH]1 |
| InChI | InChI=1S/C26H40N2O2/c1-6-7-8-9-10-11-17-30-25(29)24-27-19-22(28-24)18-20(2)14-15-23-21(3)13-12-16-26(23,4)5/h14-15,18-19H,6-13,16-17H2,1-5H3,(H,27,28) |
| InChIKey | YYVCBHUQIDHBPX-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|