C33H39NO2S — CID 54490513
N-(4-butoxyphenyl)-2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide (PubChem CID 54490513) has the molecular formula C33H39NO2S and a molecular weight of 513.75 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide.
| Compound Name | N-(4-butoxyphenyl)-2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide |
|---|---|
| PubChem CID | 54490513 |
| Molecular Formula | C33H39NO2S |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-(4-butoxyphenyl)-2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)c2ccc3cc(C=C(C)C=CC4=C(C)CCCC4(C)C)sc3c2)cc1 |
| InChI | InChI=1S/C33H39NO2S/c1-6-7-19-36-28-15-13-27(14-16-28)34-32(35)26-12-11-25-21-29(37-31(25)22-26)20-23(2)10-17-30-24(3)9-8-18-33(30,4)5/h10-17,20-22H,6-9,18-19H2,1-5H3,(H,34,35) |
| InChIKey | XVJYKUFKLBYGMS-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|