C31H46FNO2 — CID 88696133
3-ethoxy-4-[(1Z,3E)-1-fluoro-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-N-octylbenzamide (PubChem CID 88696133) has the molecular formula C31H46FNO2 and a molecular weight of 483.71 g/mol. Its IUPAC name is 3-ethoxy-4-[(1Z,3E)-1-fluoro-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-N-octylbenzamide.
| Compound Name | 3-ethoxy-4-[(1Z,3E)-1-fluoro-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-N-octylbenzamide |
|---|---|
| PubChem CID | 88696133 |
| Molecular Formula | C31H46FNO2 |
| Molecular Weight | 483.71 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | 3-ethoxy-4-[(1Z,3E)-1-fluoro-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-N-octylbenzamide |
| SMILES | CCCCCCCCNC(=O)c1ccc(/C(F)=C(C)/C=C/C2=C(C)CCCC2(C)C)c(OCC)c1 |
| InChI | InChI=1S/C31H46FNO2/c1-7-9-10-11-12-13-21-33-30(34)25-17-18-26(28(22-25)35-8-2)29(32)24(4)16-19-27-23(3)15-14-20-31(27,5)6/h16-19,22H,7-15,20-21H2,1-6H3,(H,33,34)/b19-16+,29-24- |
| InChIKey | XLXWDCJAHLWXBZ-MPTLWAPUSA-N |
| XLogP | 8.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.71 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|