C28H32F3NO3 — CID 44552929
2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-(trifluoromethyl)benzoic acid (PubChem CID 44552929) has the molecular formula C28H32F3NO3 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 44552929 |
| Molecular Formula | C28H32F3NO3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-(trifluoromethyl)benzoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2ccc(C(F)(F)F)cc2C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H32F3NO3/c1-18(11-13-23-20(3)10-7-15-27(23,4)5)8-6-9-19(2)16-25(33)32-24-14-12-21(28(29,30)31)17-22(24)26(34)35/h6,8-9,11-14,16-17H,7,10,15H2,1-5H3,(H,32,33)(H,34,35)/b9-6+,13-11+,18-8+,19-16+ |
| InChIKey | INCMBASDBUXUHQ-HPWKXKAUSA-N |
| XLogP | 7.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|