C30H34N2O — CID 91515887
N-(4-azabicyclo[5.4.0]undeca-1(7),2,3,5,8,10-hexaen-9-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 91515887) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is N-(4-azabicyclo[5.4.0]undeca-1(7),2,3,5,8,10-hexaen-9-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | N-(4-azabicyclo[5.4.0]undeca-1(7),2,3,5,8,10-hexaen-9-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 91515887 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | N-(4-azabicyclo[5.4.0]undeca-1(7),2,3,5,8,10-hexaen-9-yl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)Nc1ccc2c(c1)C=CN=C=C2 |
| InChI | InChI=1S/C30H34N2O/c1-22(11-14-28-24(3)10-7-17-30(28,4)5)8-6-9-23(2)20-29(33)32-27-13-12-25-15-18-31-19-16-26(25)21-27/h6,8-9,11-16,19-21H,7,10,17H2,1-5H3,(H,32,33) |
| InChIKey | ZYEILVVKHKUZOC-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|