C30H36NNaO5 — CID 142657707
sodium 4-[4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenoxy]-4-oxobutanoate (PubChem CID 142657707) has the molecular formula C30H36NNaO5 and a molecular weight of 513.61 g/mol. Its IUPAC name is sodium 4-[4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenoxy]-4-oxobutanoate.
| Compound Name | sodium 4-[4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenoxy]-4-oxobutanoate |
|---|---|
| PubChem CID | 142657707 |
| Molecular Formula | C30H36NNaO5 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | sodium 4-[4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenoxy]-4-oxobutanoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2ccc(OC(=O)CCC(=O)[O-])cc2)C(C)(C)CCC1.[Na+] |
| InChI | InChI=1S/C30H37NO5.Na/c1-21(11-16-26-23(3)10-7-19-30(26,4)5)8-6-9-22(2)20-27(32)31-24-12-14-25(15-13-24)36-29(35)18-17-28(33)34;/h6,8-9,11-16,20H,7,10,17-19H2,1-5H3,(H,31,32)(H,33,34);/q;+1/p-1/b9-6+,16-11+,21-8+,22-20+; |
| InChIKey | JCUZVGHUGXLPKK-WHNQWAJPSA-M |
| XLogP | 2.60 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|