C29H35NO6 — CID 59411674
[2-(4-nitrophenyl)acetyl]oxymethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 59411674) has the molecular formula C29H35NO6 and a molecular weight of 493.60 g/mol. Its IUPAC name is [2-(4-nitrophenyl)acetyl]oxymethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | [2-(4-nitrophenyl)acetyl]oxymethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 59411674 |
| Molecular Formula | C29H35NO6 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | [2-(4-nitrophenyl)acetyl]oxymethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OCOC(=O)Cc2ccc([N+](=O)[O-])cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C29H35NO6/c1-21(11-16-26-23(3)10-7-17-29(26,4)5)8-6-9-22(2)18-27(31)35-20-36-28(32)19-24-12-14-25(15-13-24)30(33)34/h6,8-9,11-16,18H,7,10,17,19-20H2,1-5H3/b9-6+,16-11+,21-8+,22-18+ |
| InChIKey | BPMRQEKDBXREHR-TZSVPEKISA-N |
| XLogP | 6.71 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|