C29H34O3 — CID 87852427
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] 4-ethenylbenzoate (PubChem CID 87852427) has the molecular formula C29H34O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] 4-ethenylbenzoate.
| Compound Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] 4-ethenylbenzoate |
|---|---|
| PubChem CID | 87852427 |
| Molecular Formula | C29H34O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OC(=O)/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)cc1 |
| InChI | InChI=1S/C29H34O3/c1-7-24-14-16-25(17-15-24)28(31)32-27(30)20-22(3)11-8-10-21(2)13-18-26-23(4)12-9-19-29(26,5)6/h7-8,10-11,13-18,20H,1,9,12,19H2,2-6H3/b11-8+,18-13+,21-10+,22-20+ |
| InChIKey | LNTXDKDFLUXKDA-FSDIUQKZSA-N |
| XLogP | 7.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|