C23H32O2 — CID 91509384
3-hydroxy-6,10-dimethyl-12-(2,6,6-trimethylcyclohexen-1-yl)dodeca-1,5,7,9,11-pentaen-4-one (PubChem CID 91509384) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 3-hydroxy-6,10-dimethyl-12-(2,6,6-trimethylcyclohexen-1-yl)dodeca-1,5,7,9,11-pentaen-4-one.
| Compound Name | 3-hydroxy-6,10-dimethyl-12-(2,6,6-trimethylcyclohexen-1-yl)dodeca-1,5,7,9,11-pentaen-4-one |
|---|---|
| PubChem CID | 91509384 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 3-hydroxy-6,10-dimethyl-12-(2,6,6-trimethylcyclohexen-1-yl)dodeca-1,5,7,9,11-pentaen-4-one |
| SMILES | C=CC(O)C(=O)C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H32O2/c1-7-21(24)22(25)16-18(3)11-8-10-17(2)13-14-20-19(4)12-9-15-23(20,5)6/h7-8,10-11,13-14,16,21,24H,1,9,12,15H2,2-6H3 |
| InChIKey | HCOAUIOSPBBNCG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|