C38H50O2 — CID 167250035
[4-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] (2E,4E,6E,8Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 167250035) has the molecular formula C38H50O2 and a molecular weight of 538.82 g/mol. Its IUPAC name is [4-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] (2E,4E,6E,8Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | [4-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] (2E,4E,6E,8Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 167250035 |
| Molecular Formula | C38H50O2 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.38 |
| IUPAC Name | [4-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] (2E,4E,6E,8Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | C=CC(C)(/C=C/c1ccc(OC(=O)/C=C(C)/C=C/C=C(C)/C=C\C2=C(C)CCCC2(C)C)cc1)CCC=C(C)C |
| InChI | InChI=1S/C38H50O2/c1-10-38(9,26-12-14-29(2)3)27-24-33-19-21-34(22-20-33)40-36(39)28-31(5)16-11-15-30(4)18-23-35-32(6)17-13-25-37(35,7)8/h10-11,14-16,18-24,27-28H,1,12-13,17,25-26H2,2-9H3/b16-11+,23-18-,27-24+,30-15+,31-28+ |
| InChIKey | CYUNBSPTPBXJRE-OYJNXRPRSA-N |
| XLogP | 11.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|