C32H33NO4 — CID 139360129
(7-oxophenoxazin-3-yl) (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 139360129) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is (7-oxophenoxazin-3-yl) (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | (7-oxophenoxazin-3-yl) (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 139360129 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (7-oxophenoxazin-3-yl) (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Oc2ccc3nc4ccc(=O)cc-4oc3c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C32H33NO4/c1-21(11-14-26-23(3)10-7-17-32(26,4)5)8-6-9-22(2)18-31(35)36-25-13-16-28-30(20-25)37-29-19-24(34)12-15-27(29)33-28/h6,8-9,11-16,18-20H,7,10,17H2,1-5H3/b9-6+,14-11+,21-8+,22-18+ |
| InChIKey | UIPXPPZNKZHWIS-JMDDXPFUSA-N |
| XLogP | 7.73 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|