C24H31NO4 — CID 87094072
(2,5-dioxopyrrolidin-1-yl) (2Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 87094072) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 87094072 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=C/C(C)=C\C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H31NO4/c1-17(11-12-20-19(3)10-7-15-24(20,4)5)8-6-9-18(2)16-23(28)29-25-21(26)13-14-22(25)27/h6,8-9,11-12,16H,7,10,13-15H2,1-5H3/b9-6?,12-11?,17-8?,18-16- |
| InChIKey | RUHGNRBGUUGLPD-UHZKLUQMSA-N |
| XLogP | 5.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|