C24H34O4 — CID 162893087
methyl 9-(6-methoxy-2,8-dimethyl-3,4-dihydrochromen-2-yl)-2,6-dimethylnona-2,6-dienoate (PubChem CID 162893087) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is methyl 9-(6-methoxy-2,8-dimethyl-3,4-dihydrochromen-2-yl)-2,6-dimethylnona-2,6-dienoate.
| Compound Name | methyl 9-(6-methoxy-2,8-dimethyl-3,4-dihydrochromen-2-yl)-2,6-dimethylnona-2,6-dienoate |
|---|---|
| PubChem CID | 162893087 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | methyl 9-(6-methoxy-2,8-dimethyl-3,4-dihydrochromen-2-yl)-2,6-dimethylnona-2,6-dienoate |
| SMILES | COC(=O)C(C)=CCCC(C)=CCCC1(C)CCc2cc(OC)cc(C)c2O1 |
| InChI | InChI=1S/C24H34O4/c1-17(9-7-11-18(2)23(25)27-6)10-8-13-24(4)14-12-20-16-21(26-5)15-19(3)22(20)28-24/h10-11,15-16H,7-9,12-14H2,1-6H3 |
| InChIKey | UIXOCCYDUKCNOO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|