C35H47NO4 — CID 162652964
(2E,6E,10E)-13-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-N-[(3-methoxyphenyl)methyl]-2,6,10-trimethyltrideca-2,6,10-trienamide (PubChem CID 162652964) has the molecular formula C35H47NO4 and a molecular weight of 545.76 g/mol. Its IUPAC name is (2E,6E,10E)-13-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-N-[(3-methoxyphenyl)methyl]-2,6,10-trimethyltrideca-2,6,10-trienamide.
| Compound Name | (2E,6E,10E)-13-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-N-[(3-methoxyphenyl)methyl]-2,6,10-trimethyltrideca-2,6,10-trienamide |
|---|---|
| PubChem CID | 162652964 |
| Molecular Formula | C35H47NO4 |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.35 |
| IUPAC Name | (2E,6E,10E)-13-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-N-[(3-methoxyphenyl)methyl]-2,6,10-trimethyltrideca-2,6,10-trienamide |
| SMILES | COc1cccc(CNC(=O)/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC[C@]2(C)CCc3cc(O)cc(C)c3O2)c1 |
| InChI | InChI=1S/C35H47NO4/c1-25(13-8-15-27(3)34(38)36-24-29-16-9-17-32(22-29)39-6)11-7-12-26(2)14-10-19-35(5)20-18-30-23-31(37)21-28(4)33(30)40-35/h9,11,14-17,21-23,37H,7-8,10,12-13,18-20,24H2,1-6H3,(H,36,38)/b25-11+,26-14+,27-15+/t35-/m1/s1 |
| InChIKey | WWOYMCMUKJEMPU-JFKYVIAOSA-N |
| XLogP | 8.29 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|