C30H47F3O3 — CID 10006637
[2,7,8-trimethyl-2-(13,13,13-trifluoro-4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate (PubChem CID 10006637) has the molecular formula C30H47F3O3 and a molecular weight of 512.70 g/mol. Its IUPAC name is [2,7,8-trimethyl-2-(13,13,13-trifluoro-4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2,7,8-trimethyl-2-(13,13,13-trifluoro-4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 10006637 |
| Molecular Formula | C30H47F3O3 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | [2,7,8-trimethyl-2-(13,13,13-trifluoro-4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c(C)c1C)OC(C)(CCCC(C)CCCC(C)CCCC(C)C(F)(F)F)CC2 |
| InChI | InChI=1S/C30H47F3O3/c1-20(13-9-15-22(3)30(31,32)33)11-8-12-21(2)14-10-17-29(7)18-16-26-19-27(35-25(6)34)23(4)24(5)28(26)36-29/h19-22H,8-18H2,1-7H3 |
| InChIKey | MOTLOFQMMQTEDS-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|