C30H46F3IO3 — CID 10326773
[8-iodo-2,5,7-trimethyl-2-(13,13,13-trifluoro-4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate (PubChem CID 10326773) has the molecular formula C30H46F3IO3 and a molecular weight of 638.59 g/mol. Its IUPAC name is [8-iodo-2,5,7-trimethyl-2-(13,13,13-trifluoro-4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [8-iodo-2,5,7-trimethyl-2-(13,13,13-trifluoro-4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 10326773 |
| Molecular Formula | C30H46F3IO3 |
| Molecular Weight | 638.59 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | [8-iodo-2,5,7-trimethyl-2-(13,13,13-trifluoro-4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(I)c2c(c1C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C(F)(F)F)O2 |
| InChI | InChI=1S/C30H46F3IO3/c1-19(13-9-15-21(3)30(31,32)33)11-8-12-20(2)14-10-17-29(7)18-16-25-22(4)27(36-24(6)35)23(5)26(34)28(25)37-29/h19-21H,8-18H2,1-7H3 |
| InChIKey | LVNNXVJFDVPLDV-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.59 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|