C40H72O7 — CID 159379343
4-O-[1-(1-hydroxypropan-2-yloxy)propan-2-yl] 1-O-[(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate;methane (PubChem CID 159379343) has the molecular formula C40H72O7 and a molecular weight of 665.01 g/mol. Its IUPAC name is 4-O-[1-(1-hydroxypropan-2-yloxy)propan-2-yl] 1-O-[(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate;methane.
| Compound Name | 4-O-[1-(1-hydroxypropan-2-yloxy)propan-2-yl] 1-O-[(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate;methane |
|---|---|
| PubChem CID | 159379343 |
| Molecular Formula | C40H72O7 |
| Molecular Weight | 665.01 g/mol |
| Exact Mass | 664.53 |
| IUPAC Name | 4-O-[1-(1-hydroxypropan-2-yloxy)propan-2-yl] 1-O-[(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate;methane |
| SMILES | C.C.Cc1c(OC(=O)CCC(=O)OC(C)COC(C)CO)cc2c(c1C)O[C@](C)(CCCC(C)CCCC(C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C38H64O7.2CH4/c1-26(2)13-10-14-27(3)15-11-16-28(4)17-12-21-38(9)22-20-33-23-34(31(7)32(8)37(33)45-38)44-36(41)19-18-35(40)43-30(6)25-42-29(5)24-39;;/h23,26-30,39H,10-22,24-25H2,1-9H3;2*1H4/t27?,28?,29?,30?,38-;;/m1../s1 |
| InChIKey | LKSAPRRSYIGIIG-POLZBVAGSA-N |
| XLogP | 10.11 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.01 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|