C18H24O6 — CID 123364993
6-(4-hydroxybutanoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 123364993) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is 6-(4-hydroxybutanoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | 6-(4-hydroxybutanoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 123364993 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 6-(4-hydroxybutanoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CCCO)CCC(C)(C(=O)O)O2 |
| InChI | InChI=1S/C18H24O6/c1-10-11(2)16-13(7-8-18(4,24-16)17(21)22)12(3)15(10)23-14(20)6-5-9-19/h19H,5-9H2,1-4H3,(H,21,22) |
| InChIKey | AGORMTULAQLENE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|