C18H24O7 — CID 163672835
(2S)-6-(4,4-dihydroxybutanoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 163672835) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is (2S)-6-(4,4-dihydroxybutanoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | (2S)-6-(4,4-dihydroxybutanoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 163672835 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (2S)-6-(4,4-dihydroxybutanoyloxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)CCC(O)O)CC[C@@](C)(C(=O)O)O2 |
| InChI | InChI=1S/C18H24O7/c1-9-10(2)16-12(7-8-18(4,25-16)17(22)23)11(3)15(9)24-14(21)6-5-13(19)20/h13,19-20H,5-8H2,1-4H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | JEBOOUGUDIYPCW-SFHVURJKSA-N |
| XLogP | 1.78 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|