C29H48O7P2+2 — CID 167334951
ethoxy-[1-[ethoxy(oxo)phosphaniumyl]-4-oxo-4-[[2,5,7,8-tetramethyl-2-(5-methylheptyl)-3,4-dihydrochromen-6-yl]oxy]butyl]-oxophosphanium (PubChem CID 167334951) has the molecular formula C29H48O7P2+2 and a molecular weight of 570.64 g/mol. Its IUPAC name is ethoxy-[1-[ethoxy(oxo)phosphaniumyl]-4-oxo-4-[[2,5,7,8-tetramethyl-2-(5-methylheptyl)-3,4-dihydrochromen-6-yl]oxy]butyl]-oxophosphanium.
| Compound Name | ethoxy-[1-[ethoxy(oxo)phosphaniumyl]-4-oxo-4-[[2,5,7,8-tetramethyl-2-(5-methylheptyl)-3,4-dihydrochromen-6-yl]oxy]butyl]-oxophosphanium |
|---|---|
| PubChem CID | 167334951 |
| Molecular Formula | C29H48O7P2+2 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | ethoxy-[1-[ethoxy(oxo)phosphaniumyl]-4-oxo-4-[[2,5,7,8-tetramethyl-2-(5-methylheptyl)-3,4-dihydrochromen-6-yl]oxy]butyl]-oxophosphanium |
| SMILES | CCO[P+](=O)C(CCC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CCCCC(C)CC)O2)[P+](=O)OCC |
| InChI | InChI=1S/C29H48O7P2/c1-9-20(4)14-12-13-18-29(8)19-17-24-23(7)27(21(5)22(6)28(24)36-29)35-25(30)15-16-26(37(31)33-10-2)38(32)34-11-3/h20,26H,9-19H2,1-8H3/q+2 |
| InChIKey | KSXJKKLPSOXSAY-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|