About 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid
6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 138473069) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid.
Analyze 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid?
The IUPAC name of 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid (CID 138473069) is 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid.
What is the SMILES notation for 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid?
The canonical SMILES for 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid is Cc1cc(O)cc2c1OC(C)(C(=O)O)CC2.
What is the InChIKey of 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid?
The InChIKey is SJRDOSYEYKEZQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-7-5-9(13)6-8-3-4-12(2,11(14)15)16-10(7)8/h5-6,13H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid?
6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid has a molecular weight of 222.24 g/mol, XLogP of 1.87, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,8-dimethyl-3,4-dihydrochromene-2-carboxylic acid is sourced from PubChem (CID 138473069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).