C18H26O — CID 134936952
6-tert-butyl-2,8-dimethyl-2-prop-1-en-2-yl-3,4-dihydrochromene (PubChem CID 134936952) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 6-tert-butyl-2,8-dimethyl-2-prop-1-en-2-yl-3,4-dihydrochromene.
| Compound Name | 6-tert-butyl-2,8-dimethyl-2-prop-1-en-2-yl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 134936952 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 6-tert-butyl-2,8-dimethyl-2-prop-1-en-2-yl-3,4-dihydrochromene |
| SMILES | C=C(C)C1(C)CCc2cc(C(C)(C)C)cc(C)c2O1 |
| InChI | InChI=1S/C18H26O/c1-12(2)18(7)9-8-14-11-15(17(4,5)6)10-13(3)16(14)19-18/h10-11H,1,8-9H2,2-7H3 |
| InChIKey | YPBKINOXRFDTOR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|