C17H24O3 — CID 142093790
(2S)-2-(1-hydroxy-2-methylprop-2-enyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol (PubChem CID 142093790) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2S)-2-(1-hydroxy-2-methylprop-2-enyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol.
| Compound Name | (2S)-2-(1-hydroxy-2-methylprop-2-enyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 142093790 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2S)-2-(1-hydroxy-2-methylprop-2-enyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| SMILES | C=C(C)C(O)[C@]1(C)CCc2c(C)c(O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C17H24O3/c1-9(2)16(19)17(6)8-7-13-12(5)14(18)10(3)11(4)15(13)20-17/h16,18-19H,1,7-8H2,2-6H3/t16?,17-/m0/s1 |
| InChIKey | OHVJGDSZQQDKIG-DJNXLDHESA-N |
| XLogP | 3.34 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|