C15H19BrO3 — CID 87890937
2-bromo-2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)acetaldehyde (PubChem CID 87890937) has the molecular formula C15H19BrO3 and a molecular weight of 327.22 g/mol. Its IUPAC name is 2-bromo-2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)acetaldehyde.
| Compound Name | 2-bromo-2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 87890937 |
| Molecular Formula | C15H19BrO3 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-bromo-2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)acetaldehyde |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C(Br)C=O)O2 |
| InChI | InChI=1S/C15H19BrO3/c1-8-9(2)14-11(10(3)13(8)18)5-6-15(4,19-14)12(16)7-17/h7,12,18H,5-6H2,1-4H3 |
| InChIKey | IECKKTQFIAAOLX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|