C19H22ClN5O8S — CID 57128445
(2S)-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid (PubChem CID 57128445) has the molecular formula C19H22ClN5O8S and a molecular weight of 515.93 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 57128445 |
| Molecular Formula | C19H22ClN5O8S |
| Molecular Weight | 515.93 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | (2S)-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]propanoic acid |
| SMILES | NC(N)=NOCCCOc1ccc(C[C@H](NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H22ClN5O8S/c20-15-7-6-14(11-17(15)25(28)29)34(30,31)24-16(18(26)27)10-12-2-4-13(5-3-12)32-8-1-9-33-23-19(21)22/h2-7,11,16,24H,1,8-10H2,(H,26,27)(H4,21,22,23)/t16-/m0/s1 |
| InChIKey | BLCVRNAYQPBTAX-INIZCTEOSA-N |
| XLogP | 1.20 |
| TPSA | 209.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.93 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|