C17H20Br2N4O6S2 — CID 22946557
(2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(4,5-dibromothiophen-2-yl)sulfonylamino]propanoic acid (PubChem CID 22946557) has the molecular formula C17H20Br2N4O6S2 and a molecular weight of 600.31 g/mol. Its IUPAC name is (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(4,5-dibromothiophen-2-yl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(4,5-dibromothiophen-2-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 22946557 |
| Molecular Formula | C17H20Br2N4O6S2 |
| Molecular Weight | 600.31 g/mol |
| Exact Mass | 597.92 |
| IUPAC Name | (2S)-3-[4-[3-(diaminomethylideneamino)oxypropoxy]phenyl]-2-[(4,5-dibromothiophen-2-yl)sulfonylamino]propanoic acid |
| SMILES | NC(N)=NOCCCOc1ccc(C[C@H](NS(=O)(=O)c2cc(Br)c(Br)s2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H20Br2N4O6S2/c18-12-9-14(30-15(12)19)31(26,27)23-13(16(24)25)8-10-2-4-11(5-3-10)28-6-1-7-29-22-17(20)21/h2-5,9,13,23H,1,6-8H2,(H,24,25)(H4,20,21,22)/t13-/m0/s1 |
| InChIKey | MFUJLRAWZYUGAC-ZDUSSCGKSA-N |
| XLogP | 2.22 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|