C10H15FN4O5 — CID 117067931
2-[3-(4-fluorophenoxy)propoxy]guanidine;nitric acid (PubChem CID 117067931) has the molecular formula C10H15FN4O5 and a molecular weight of 290.25 g/mol. Its IUPAC name is 2-[3-(4-fluorophenoxy)propoxy]guanidine;nitric acid.
| Compound Name | 2-[3-(4-fluorophenoxy)propoxy]guanidine;nitric acid |
|---|---|
| PubChem CID | 117067931 |
| Molecular Formula | C10H15FN4O5 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[3-(4-fluorophenoxy)propoxy]guanidine;nitric acid |
| SMILES | NC(N)=NOCCCOc1ccc(F)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C10H14FN3O2.HNO3/c11-8-2-4-9(5-3-8)15-6-1-7-16-14-10(12)13;2-1(3)4/h2-5H,1,6-7H2,(H4,12,13,14);(H,2,3,4) |
| InChIKey | DFRXTPRLXSAIJE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 146.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|