C21H17FN2O6 — CID 22360131
2-[3-[4-(4-fluorophenyl)phenoxy]propoxy]-1,3-dinitrobenzene (PubChem CID 22360131) has the molecular formula C21H17FN2O6 and a molecular weight of 412.37 g/mol. Its IUPAC name is 2-[3-[4-(4-fluorophenyl)phenoxy]propoxy]-1,3-dinitrobenzene.
| Compound Name | 2-[3-[4-(4-fluorophenyl)phenoxy]propoxy]-1,3-dinitrobenzene |
|---|---|
| PubChem CID | 22360131 |
| Molecular Formula | C21H17FN2O6 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-[3-[4-(4-fluorophenyl)phenoxy]propoxy]-1,3-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1OCCCOc1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H17FN2O6/c22-17-9-5-15(6-10-17)16-7-11-18(12-8-16)29-13-2-14-30-21-19(23(25)26)3-1-4-20(21)24(27)28/h1,3-12H,2,13-14H2 |
| InChIKey | PAOHOIRNSGKDLW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|