C9H13ClN4O4 — CID 117067467
2-[2-(4-chlorophenoxy)ethyl]guanidine;nitric acid (PubChem CID 117067467) has the molecular formula C9H13ClN4O4 and a molecular weight of 276.68 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethyl]guanidine;nitric acid.
| Compound Name | 2-[2-(4-chlorophenoxy)ethyl]guanidine;nitric acid |
|---|---|
| PubChem CID | 117067467 |
| Molecular Formula | C9H13ClN4O4 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethyl]guanidine;nitric acid |
| SMILES | NC(N)=NCCOc1ccc(Cl)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C9H12ClN3O.HNO3/c10-7-1-3-8(4-2-7)14-6-5-13-9(11)12;2-1(3)4/h1-4H,5-6H2,(H4,11,12,13);(H,2,3,4) |
| InChIKey | FCZFOSQOBSKUCI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|