C10H14Cl2N4O4 — CID 117067498
2-[3-(3,4-dichlorophenoxy)propyl]guanidine;nitric acid (PubChem CID 117067498) has the molecular formula C10H14Cl2N4O4 and a molecular weight of 325.15 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenoxy)propyl]guanidine;nitric acid.
| Compound Name | 2-[3-(3,4-dichlorophenoxy)propyl]guanidine;nitric acid |
|---|---|
| PubChem CID | 117067498 |
| Molecular Formula | C10H14Cl2N4O4 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-[3-(3,4-dichlorophenoxy)propyl]guanidine;nitric acid |
| SMILES | NC(N)=NCCCOc1ccc(Cl)c(Cl)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C10H13Cl2N3O.HNO3/c11-8-3-2-7(6-9(8)12)16-5-1-4-15-10(13)14;2-1(3)4/h2-3,6H,1,4-5H2,(H4,13,14,15);(H,2,3,4) |
| InChIKey | CIICMXFETXACQF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|