C17H28N2O5S — CID 59925525
(2R)-3-[4-(4-aminobutoxy)phenyl]-2-(butylsulfonylamino)propanoic acid (PubChem CID 59925525) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is (2R)-3-[4-(4-aminobutoxy)phenyl]-2-(butylsulfonylamino)propanoic acid.
| Compound Name | (2R)-3-[4-(4-aminobutoxy)phenyl]-2-(butylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 59925525 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (2R)-3-[4-(4-aminobutoxy)phenyl]-2-(butylsulfonylamino)propanoic acid |
| SMILES | CCCCS(=O)(=O)N[C@H](Cc1ccc(OCCCCN)cc1)C(=O)O |
| InChI | InChI=1S/C17H28N2O5S/c1-2-3-12-25(22,23)19-16(17(20)21)13-14-6-8-15(9-7-14)24-11-5-4-10-18/h6-9,16,19H,2-5,10-13,18H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | RPZYSJMCDZUUPA-MRXNPFEDSA-N |
| XLogP | 1.52 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|