C20H34N2O5S — CID 10070417
methyl (2S)-3-[4-(6-aminohexoxy)phenyl]-2-(butylsulfonylamino)propanoate (PubChem CID 10070417) has the molecular formula C20H34N2O5S and a molecular weight of 414.57 g/mol. Its IUPAC name is methyl (2S)-3-[4-(6-aminohexoxy)phenyl]-2-(butylsulfonylamino)propanoate.
| Compound Name | methyl (2S)-3-[4-(6-aminohexoxy)phenyl]-2-(butylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 10070417 |
| Molecular Formula | C20H34N2O5S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | methyl (2S)-3-[4-(6-aminohexoxy)phenyl]-2-(butylsulfonylamino)propanoate |
| SMILES | CCCCS(=O)(=O)N[C@@H](Cc1ccc(OCCCCCCN)cc1)C(=O)OC |
| InChI | InChI=1S/C20H34N2O5S/c1-3-4-15-28(24,25)22-19(20(23)26-2)16-17-9-11-18(12-10-17)27-14-8-6-5-7-13-21/h9-12,19,22H,3-8,13-16,21H2,1-2H3/t19-/m0/s1 |
| InChIKey | WJHFCJKMFNNFKH-IBGZPJMESA-N |
| XLogP | 2.39 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|