C16H26N2O5S — CID 70075548
methyl 2-(butylsulfonylamino)-3-[4-(2-hydroxyethylamino)phenyl]propanoate (PubChem CID 70075548) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is methyl 2-(butylsulfonylamino)-3-[4-(2-hydroxyethylamino)phenyl]propanoate.
| Compound Name | methyl 2-(butylsulfonylamino)-3-[4-(2-hydroxyethylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 70075548 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | methyl 2-(butylsulfonylamino)-3-[4-(2-hydroxyethylamino)phenyl]propanoate |
| SMILES | CCCCS(=O)(=O)NC(Cc1ccc(NCCO)cc1)C(=O)OC |
| InChI | InChI=1S/C16H26N2O5S/c1-3-4-11-24(21,22)18-15(16(20)23-2)12-13-5-7-14(8-6-13)17-9-10-19/h5-8,15,17-19H,3-4,9-12H2,1-2H3 |
| InChIKey | FPIDWXZESMHROX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |