C9H18N2O5S — CID 57264871
methyl 4-amino-2-(butylsulfonylamino)-4-oxobutanoate (PubChem CID 57264871) has the molecular formula C9H18N2O5S and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl 4-amino-2-(butylsulfonylamino)-4-oxobutanoate.
| Compound Name | methyl 4-amino-2-(butylsulfonylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 57264871 |
| Molecular Formula | C9H18N2O5S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | methyl 4-amino-2-(butylsulfonylamino)-4-oxobutanoate |
| SMILES | CCCCS(=O)(=O)NC(CC(N)=O)C(=O)OC |
| InChI | InChI=1S/C9H18N2O5S/c1-3-4-5-17(14,15)11-7(6-8(10)12)9(13)16-2/h7,11H,3-6H2,1-2H3,(H2,10,12) |
| InChIKey | OPDABLPECQUWOK-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |