C14H27N3O6S — CID 146381943
(2S)-2-[[(2R)-4-amino-2-(heptylsulfonylamino)-4-oxobutanoyl]amino]propanoic acid (PubChem CID 146381943) has the molecular formula C14H27N3O6S and a molecular weight of 365.45 g/mol. Its IUPAC name is (2S)-2-[[(2R)-4-amino-2-(heptylsulfonylamino)-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2R)-4-amino-2-(heptylsulfonylamino)-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 146381943 |
| Molecular Formula | C14H27N3O6S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (2S)-2-[[(2R)-4-amino-2-(heptylsulfonylamino)-4-oxobutanoyl]amino]propanoic acid |
| SMILES | CCCCCCCS(=O)(=O)N[C@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C14H27N3O6S/c1-3-4-5-6-7-8-24(22,23)17-11(9-12(15)18)13(19)16-10(2)14(20)21/h10-11,17H,3-9H2,1-2H3,(H2,15,18)(H,16,19)(H,20,21)/t10-,11+/m0/s1 |
| InChIKey | FWSNDAVGSSYKDI-WDEREUQCSA-N |
| XLogP | -0.29 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|