C20H24INO4S — CID 140990978
benzyl 2-(butylsulfonylamino)-3-(4-iodophenyl)propanoate (PubChem CID 140990978) has the molecular formula C20H24INO4S and a molecular weight of 501.39 g/mol. Its IUPAC name is benzyl 2-(butylsulfonylamino)-3-(4-iodophenyl)propanoate.
| Compound Name | benzyl 2-(butylsulfonylamino)-3-(4-iodophenyl)propanoate |
|---|---|
| PubChem CID | 140990978 |
| Molecular Formula | C20H24INO4S |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | benzyl 2-(butylsulfonylamino)-3-(4-iodophenyl)propanoate |
| SMILES | CCCCS(=O)(=O)NC(Cc1ccc(I)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H24INO4S/c1-2-3-13-27(24,25)22-19(14-16-9-11-18(21)12-10-16)20(23)26-15-17-7-5-4-6-8-17/h4-12,19,22H,2-3,13-15H2,1H3 |
| InChIKey | HELAYVLURDSQOB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|