C25H35N3O6S — CID 67674550
benzyl (2S)-2-(butylsulfonylamino)-3-[4-[5-(2-oxohydrazinyl)pentoxy]phenyl]propanoate (PubChem CID 67674550) has the molecular formula C25H35N3O6S and a molecular weight of 505.64 g/mol. Its IUPAC name is benzyl (2S)-2-(butylsulfonylamino)-3-[4-[5-(2-oxohydrazinyl)pentoxy]phenyl]propanoate.
| Compound Name | benzyl (2S)-2-(butylsulfonylamino)-3-[4-[5-(2-oxohydrazinyl)pentoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 67674550 |
| Molecular Formula | C25H35N3O6S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | benzyl (2S)-2-(butylsulfonylamino)-3-[4-[5-(2-oxohydrazinyl)pentoxy]phenyl]propanoate |
| SMILES | CCCCS(=O)(=O)N[C@@H](Cc1ccc(OCCCCCNN=O)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H35N3O6S/c1-2-3-18-35(31,32)27-24(25(29)34-20-22-10-6-4-7-11-22)19-21-12-14-23(15-13-21)33-17-9-5-8-16-26-28-30/h4,6-7,10-15,24,27H,2-3,5,8-9,16-20H2,1H3,(H,26,30)/t24-/m0/s1 |
| InChIKey | VEGRMJFFPLPHFC-DEOSSOPVSA-N |
| XLogP | 3.88 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|