C33H46N2O9S — CID 10604243
(Z)-3-[2-[(2S)-2-(butylsulfonylamino)-3-[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]propanoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 10604243) has the molecular formula C33H46N2O9S and a molecular weight of 646.80 g/mol. Its IUPAC name is (Z)-3-[2-[(2S)-2-(butylsulfonylamino)-3-[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]propanoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[2-[(2S)-2-(butylsulfonylamino)-3-[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]propanoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10604243 |
| Molecular Formula | C33H46N2O9S |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | (Z)-3-[2-[(2S)-2-(butylsulfonylamino)-3-[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]propanoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | CCCCS(=O)(=O)N[C@@H](Cc1ccc(OCCCCCCNC(=O)OC(C)(C)C)cc1)C(=O)Oc1ccccc1/C=C\C(=O)O |
| InChI | InChI=1S/C33H46N2O9S/c1-5-6-23-45(40,41)35-28(31(38)43-29-14-10-9-13-26(29)17-20-30(36)37)24-25-15-18-27(19-16-25)42-22-12-8-7-11-21-34-32(39)44-33(2,3)4/h9-10,13-20,28,35H,5-8,11-12,21-24H2,1-4H3,(H,34,39)(H,36,37)/b20-17-/t28-/m0/s1 |
| InChIKey | UNDKKCDXWHMKFC-RUQSAVHZSA-N |
| XLogP | 5.48 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|