C31H41N3O5S — CID 175666295
4-pyridin-4-ylbutyl (2S)-2-(butylsulfonylamino)-3-[4-(4-pyridin-4-ylbutoxy)phenyl]propanoate (PubChem CID 175666295) has the molecular formula C31H41N3O5S and a molecular weight of 567.75 g/mol. Its IUPAC name is 4-pyridin-4-ylbutyl (2S)-2-(butylsulfonylamino)-3-[4-(4-pyridin-4-ylbutoxy)phenyl]propanoate.
| Compound Name | 4-pyridin-4-ylbutyl (2S)-2-(butylsulfonylamino)-3-[4-(4-pyridin-4-ylbutoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 175666295 |
| Molecular Formula | C31H41N3O5S |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 4-pyridin-4-ylbutyl (2S)-2-(butylsulfonylamino)-3-[4-(4-pyridin-4-ylbutoxy)phenyl]propanoate |
| SMILES | CCCCS(=O)(=O)N[C@@H](Cc1ccc(OCCCCc2ccncc2)cc1)C(=O)OCCCCc1ccncc1 |
| InChI | InChI=1S/C31H41N3O5S/c1-2-3-24-40(36,37)34-30(31(35)39-23-7-5-9-27-16-20-33-21-17-27)25-28-10-12-29(13-11-28)38-22-6-4-8-26-14-18-32-19-15-26/h10-21,30,34H,2-9,22-25H2,1H3/t30-/m0/s1 |
| InChIKey | LORVLBSWDDZBET-PMERELPUSA-N |
| XLogP | 5.07 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|