C30H44N6O5S — CID 70086984
2-[4-[5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperazin-1-yl]ethyl propanoate (PubChem CID 70086984) has the molecular formula C30H44N6O5S and a molecular weight of 600.79 g/mol. Its IUPAC name is 2-[4-[5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperazin-1-yl]ethyl propanoate.
| Compound Name | 2-[4-[5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperazin-1-yl]ethyl propanoate |
|---|---|
| PubChem CID | 70086984 |
| Molecular Formula | C30H44N6O5S |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | 2-[4-[5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperazin-1-yl]ethyl propanoate |
| SMILES | CCC(=O)OCCN1CCN(C(=O)C(CCCN=C(N)N)NS(=O)(=O)c2cccc(C(C)(C)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C30H44N6O5S/c1-4-27(37)41-21-20-35-16-18-36(19-17-35)28(38)26(14-9-15-33-29(31)32)34-42(39,40)25-13-8-12-24(22-25)30(2,3)23-10-6-5-7-11-23/h5-8,10-13,22,26,34H,4,9,14-21H2,1-3H3,(H4,31,32,33) |
| InChIKey | MMFUKHMDNJIEKN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 160.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|