C26H43N7O5S — CID 70089396
6-[4-[(2S)-5-(diaminomethylideneamino)-2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]pentanoyl]piperazin-1-yl]hexanoic acid (PubChem CID 70089396) has the molecular formula C26H43N7O5S and a molecular weight of 565.74 g/mol. Its IUPAC name is 6-[4-[(2S)-5-(diaminomethylideneamino)-2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]pentanoyl]piperazin-1-yl]hexanoic acid.
| Compound Name | 6-[4-[(2S)-5-(diaminomethylideneamino)-2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]pentanoyl]piperazin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 70089396 |
| Molecular Formula | C26H43N7O5S |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | 6-[4-[(2S)-5-(diaminomethylideneamino)-2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]pentanoyl]piperazin-1-yl]hexanoic acid |
| SMILES | CC1CNc2c(cccc2S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CCN(CCCCCC(=O)O)CC2)C1 |
| InChI | InChI=1S/C26H43N7O5S/c1-19-17-20-7-5-9-22(24(20)30-18-19)39(37,38)31-21(8-6-11-29-26(27)28)25(36)33-15-13-32(14-16-33)12-4-2-3-10-23(34)35/h5,7,9,19,21,30-31H,2-4,6,8,10-18H2,1H3,(H,34,35)(H4,27,28,29)/t19?,21-/m0/s1 |
| InChIKey | ZBFYHPVPIDZBDK-QWAKEFERSA-N |
| XLogP | 0.78 |
| TPSA | 183.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|