C28H40ClN5O3S — CID 56999932
2-[5-[4-(2-chloroethyl)piperidin-1-yl]-5-oxo-4-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentyl]guanidine (PubChem CID 56999932) has the molecular formula C28H40ClN5O3S and a molecular weight of 562.18 g/mol. Its IUPAC name is 2-[5-[4-(2-chloroethyl)piperidin-1-yl]-5-oxo-4-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentyl]guanidine.
| Compound Name | 2-[5-[4-(2-chloroethyl)piperidin-1-yl]-5-oxo-4-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentyl]guanidine |
|---|---|
| PubChem CID | 56999932 |
| Molecular Formula | C28H40ClN5O3S |
| Molecular Weight | 562.18 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 2-[5-[4-(2-chloroethyl)piperidin-1-yl]-5-oxo-4-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentyl]guanidine |
| SMILES | CC(C)(c1ccccc1)c1cccc(S(=O)(=O)NC(CCCN=C(N)N)C(=O)N2CCC(CCCl)CC2)c1 |
| InChI | InChI=1S/C28H40ClN5O3S/c1-28(2,22-8-4-3-5-9-22)23-10-6-11-24(20-23)38(36,37)33-25(12-7-17-32-27(30)31)26(35)34-18-14-21(13-16-29)15-19-34/h3-6,8-11,20-21,25,33H,7,12-19H2,1-2H3,(H4,30,31,32) |
| InChIKey | KXLWRVHCRPVFAB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|