C25H41N5O3 — CID 58559676
(2R,4R)-1-[(2S)-5-(diaminomethylideneamino)-2-[(6-methyl-4a,5,6,7,8,8a-hexahydronaphthalen-1-yl)methylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid (PubChem CID 58559676) has the molecular formula C25H41N5O3 and a molecular weight of 459.64 g/mol. Its IUPAC name is (2R,4R)-1-[(2S)-5-(diaminomethylideneamino)-2-[(6-methyl-4a,5,6,7,8,8a-hexahydronaphthalen-1-yl)methylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid.
| Compound Name | (2R,4R)-1-[(2S)-5-(diaminomethylideneamino)-2-[(6-methyl-4a,5,6,7,8,8a-hexahydronaphthalen-1-yl)methylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58559676 |
| Molecular Formula | C25H41N5O3 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | (2R,4R)-1-[(2S)-5-(diaminomethylideneamino)-2-[(6-methyl-4a,5,6,7,8,8a-hexahydronaphthalen-1-yl)methylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid |
| SMILES | CC1CCC2C(CN[C@@H](CCCN=C(N)N)C(=O)N3CC[C@@H](C)C[C@@H]3C(=O)O)=CC=CC2C1 |
| InChI | InChI=1S/C25H41N5O3/c1-16-8-9-20-18(13-16)5-3-6-19(20)15-29-21(7-4-11-28-25(26)27)23(31)30-12-10-17(2)14-22(30)24(32)33/h3,5-6,16-18,20-22,29H,4,7-15H2,1-2H3,(H,32,33)(H4,26,27,28)/t16?,17-,18?,20?,21+,22-/m1/s1 |
| InChIKey | LCFSZJTYOFLIJW-STQFNMNUSA-N |
| XLogP | 2.26 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|