C38H64N4O7S — CID 53358550
N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexyl]-N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]octanamide (PubChem CID 53358550) has the molecular formula C38H64N4O7S and a molecular weight of 721.02 g/mol. Its IUPAC name is N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexyl]-N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]octanamide.
| Compound Name | N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexyl]-N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]octanamide |
|---|---|
| PubChem CID | 53358550 |
| Molecular Formula | C38H64N4O7S |
| Molecular Weight | 721.02 g/mol |
| Exact Mass | 720.45 |
| IUPAC Name | N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexyl]-N-[6-[(2R,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]octanamide |
| SMILES | CCCCCCCC(=O)N(CCCCCCNS(=O)(=O)c1cccc2c(N(C)C)cccc12)CCCCCCN1C[C@H](O)[C@@H](O)[C@@H](O)[C@H]1CO |
| InChI | InChI=1S/C38H64N4O7S/c1-4-5-6-7-12-23-36(45)41(26-15-10-11-16-27-42-28-34(44)38(47)37(46)33(42)29-43)25-14-9-8-13-24-39-50(48,49)35-22-18-19-30-31(35)20-17-21-32(30)40(2)3/h17-22,33-34,37-39,43-44,46-47H,4-16,23-29H2,1-3H3/t33-,34+,37+,38-/m1/s1 |
| InChIKey | CQNJCXVUKCXOQN-VIJSKAGKSA-N |
| XLogP | 4.25 |
| TPSA | 153.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.02 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|