C47H54N4O5S — CID 68881212
N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]-6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanamide (PubChem CID 68881212) has the molecular formula C47H54N4O5S and a molecular weight of 787.04 g/mol. Its IUPAC name is N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]-6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanamide.
| Compound Name | N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]-6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanamide |
|---|---|
| PubChem CID | 68881212 |
| Molecular Formula | C47H54N4O5S |
| Molecular Weight | 787.04 g/mol |
| Exact Mass | 786.38 |
| IUPAC Name | N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]-6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanamide |
| SMILES | Cc1cccc(C2C(C(=O)c3ccccc3)CN(CCNC(=O)CCCCCNS(=O)(=O)c3cccc4c(N(C)C)cccc34)CC2C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C47H54N4O5S/c1-33-17-14-22-37(34(33)2)45-40(46(53)35-18-8-5-9-19-35)31-51(32-41(45)47(54)36-20-10-6-11-21-36)30-29-48-44(52)27-12-7-13-28-49-57(55,56)43-26-16-23-38-39(43)24-15-25-42(38)50(3)4/h5-6,8-11,14-26,40-41,45,49H,7,12-13,27-32H2,1-4H3,(H,48,52) |
| InChIKey | CQJBCNMBDFTKQE-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.04 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|