About methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate
methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate (PubChem CID 16725625) has the molecular formula C31H34N2O4
and a molecular weight of 498.62 g/mol. Its IUPAC name is methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate |
| PubChem CID | 16725625 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate |
| SMILES | COC(=O)NCCN1CC(C(=O)c2ccccc2)C(c2cccc(C)c2C)C(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C31H34N2O4/c1-21-11-10-16-25(22(21)2)28-26(29(34)23-12-6-4-7-13-23)19-33(18-17-32-31(36)37-3)20-27(28)30(35)24-14-8-5-9-15-24/h4-16,26-28H,17-20H2,1-3H3,(H,32,36) |
| InChIKey | WLCCHQBNSYIADN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate?
The IUPAC name of methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate (CID 16725625) is methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate.
What is the SMILES notation for methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate?
The canonical SMILES for methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate is COC(=O)NCCN1CC(C(=O)c2ccccc2)C(c2cccc(C)c2C)C(C(=O)c2ccccc2)C1.
What is the InChIKey of methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate?
The InChIKey is WLCCHQBNSYIADN-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H34N2O4/c1-21-11-10-16-25(22(21)2)28-26(29(34)23-12-6-4-7-13-23)19-33(18-17-32-31(36)37-3)20-27(28)30(35)24-14-8-5-9-15-24/h4-16,26-28H,17-20H2,1-3H3,(H,32,36).
What are the key properties of methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate?
methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate has a molecular weight of 498.62 g/mol, XLogP of 5.06, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]ethyl]carbamate is sourced from PubChem (CID 16725625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).