C30H31NO3 — CID 16725440
1-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]propan-1-one (PubChem CID 16725440) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is 1-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]propan-1-one.
| Compound Name | 1-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 16725440 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 1-[3,5-dibenzoyl-4-(2,3-dimethylphenyl)piperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CC(C(=O)c2ccccc2)C(c2cccc(C)c2C)C(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C30H31NO3/c1-4-27(32)31-18-25(29(33)22-13-7-5-8-14-22)28(24-17-11-12-20(2)21(24)3)26(19-31)30(34)23-15-9-6-10-16-23/h5-17,25-26,28H,4,18-19H2,1-3H3 |
| InChIKey | CXVOLHVVQNZQQP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |