About 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one
4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one (PubChem CID 69183077) has the molecular formula C30H31NO2
and a molecular weight of 437.58 g/mol. Its IUPAC name is 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one.
Molecular Properties
| Compound Name | 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one |
| PubChem CID | 69183077 |
| Molecular Formula | C30H31NO2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one |
| SMILES | Cc1cccc(C2C(CC=CC(=O)c3ccccc3)CNCC2C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C30H31NO2/c1-21-11-9-17-26(22(21)2)29-25(16-10-18-28(32)23-12-5-3-6-13-23)19-31-20-27(29)30(33)24-14-7-4-8-15-24/h3-15,17-18,25,27,29,31H,16,19-20H2,1-2H3 |
| InChIKey | LKSUBPQPDFLAKN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one?
The IUPAC name of 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one (CID 69183077) is 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one.
What is the SMILES notation for 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one?
The canonical SMILES for 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one is Cc1cccc(C2C(CC=CC(=O)c3ccccc3)CNCC2C(=O)c2ccccc2)c1C.
What is the InChIKey of 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one?
The InChIKey is LKSUBPQPDFLAKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31NO2/c1-21-11-9-17-26(22(21)2)29-25(16-10-18-28(32)23-12-5-3-6-13-23)19-31-20-27(29)30(33)24-14-7-4-8-15-24/h3-15,17-18,25,27,29,31H,16,19-20H2,1-2H3.
What are the key properties of 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one?
4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one has a molecular weight of 437.58 g/mol, XLogP of 5.93, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-1-phenylbut-2-en-1-one is sourced from PubChem (CID 69183077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).